C21H34O3 — CID 11977298
2-[(3S)-3-methyl-8-phenylmethoxyoctoxy]oxane (PubChem CID 11977298) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 2-[(3S)-3-methyl-8-phenylmethoxyoctoxy]oxane.
| Compound Name | 2-[(3S)-3-methyl-8-phenylmethoxyoctoxy]oxane |
|---|---|
| PubChem CID | 11977298 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 2-[(3S)-3-methyl-8-phenylmethoxyoctoxy]oxane |
| SMILES | C[C@@H](CCCCCOCc1ccccc1)CCOC1CCCCO1 |
| InChI | InChI=1S/C21H34O3/c1-19(14-17-24-21-13-7-9-16-23-21)10-4-3-8-15-22-18-20-11-5-2-6-12-20/h2,5-6,11-12,19,21H,3-4,7-10,13-18H2,1H3/t19-,21?/m0/s1 |
| InChIKey | KMNIMACJNULBAW-ZQRQZVKFSA-N |
| XLogP | 5.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|