C20H40O2 — CID 70570325
2-[(3S,7R)-3,7,11-trimethyldodecoxy]oxane (PubChem CID 70570325) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 2-[(3S,7R)-3,7,11-trimethyldodecoxy]oxane.
| Compound Name | 2-[(3S,7R)-3,7,11-trimethyldodecoxy]oxane |
|---|---|
| PubChem CID | 70570325 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 2-[(3S,7R)-3,7,11-trimethyldodecoxy]oxane |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@H](C)CCOC1CCCCO1 |
| InChI | InChI=1S/C20H40O2/c1-17(2)9-7-10-18(3)11-8-12-19(4)14-16-22-20-13-5-6-15-21-20/h17-20H,5-16H2,1-4H3/t18-,19+,20?/m1/s1 |
| InChIKey | RTIXBADKSCNGHV-LFPSWIHMSA-N |
| XLogP | 6.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |