About 2-(6-methylheptoxy)oxane
2-(6-methylheptoxy)oxane (PubChem CID 139685112) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-(6-methylheptoxy)oxane.
Molecular Properties
| Compound Name | 2-(6-methylheptoxy)oxane |
| PubChem CID | 139685112 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 2-(6-methylheptoxy)oxane |
| SMILES | CC(C)CCCCCOC1CCCCO1 |
| InChI | InChI=1S/C13H26O2/c1-12(2)8-4-3-6-10-14-13-9-5-7-11-15-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | CESHXGDOTIAKSM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-methylheptoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methylheptoxy)oxane?
The IUPAC name of 2-(6-methylheptoxy)oxane (CID 139685112) is 2-(6-methylheptoxy)oxane.
What is the SMILES notation for 2-(6-methylheptoxy)oxane?
The canonical SMILES for 2-(6-methylheptoxy)oxane is CC(C)CCCCCOC1CCCCO1.
What is the InChIKey of 2-(6-methylheptoxy)oxane?
The InChIKey is CESHXGDOTIAKSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-12(2)8-4-3-6-10-14-13-9-5-7-11-15-13/h12-13H,3-11H2,1-2H3.
What are the key properties of 2-(6-methylheptoxy)oxane?
2-(6-methylheptoxy)oxane has a molecular weight of 214.35 g/mol, XLogP of 3.75, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methylheptoxy)oxane is sourced from PubChem (CID 139685112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).