About Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane
Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane (PubChem CID 78062562) has the molecular formula C23H45O4Si
and a molecular weight of 413.70 g/mol.
Molecular Properties
| Compound Name | Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane |
| PubChem CID | 78062562 |
| Molecular Formula | C23H45O4Si |
| Molecular Weight | 413.70 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | — |
| SMILES | C[Si](CCCCCCOC1CCCCO1)CCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C23H45O4Si/c1-28(20-12-4-2-8-16-24-22-14-6-10-18-26-22)21-13-5-3-9-17-25-23-15-7-11-19-27-23/h22-23H,2-21H2,1H3 |
| InChIKey | XAJLJTIWEQLZRT-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.70 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane?
The IUPAC name of Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane (CID 78062562) is not available.
What is the SMILES notation for Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane?
The canonical SMILES for Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane is C[Si](CCCCCCOC1CCCCO1)CCCCCCOC1CCCCO1.
What is the InChIKey of Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane?
The InChIKey is XAJLJTIWEQLZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H45O4Si/c1-28(20-12-4-2-8-16-24-22-14-6-10-18-26-22)21-13-5-3-9-17-25-23-15-7-11-19-27-23/h22-23H,2-21H2,1H3.
What are the key properties of Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane?
Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane has a molecular weight of 413.70 g/mol, XLogP of 6.32, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Methylbis{6-[(oxan-2-yl)oxy]hexyl}silane is sourced from PubChem (CID 78062562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).