C13H26O4 — CID 11831727
(3S)-8-(oxan-2-yloxy)octane-1,3-diol (PubChem CID 11831727) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is (3S)-8-(oxan-2-yloxy)octane-1,3-diol.
| Compound Name | (3S)-8-(oxan-2-yloxy)octane-1,3-diol |
|---|---|
| PubChem CID | 11831727 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (3S)-8-(oxan-2-yloxy)octane-1,3-diol |
| SMILES | OCC[C@@H](O)CCCCCOC1CCCCO1 |
| InChI | InChI=1S/C13H26O4/c14-9-8-12(15)6-2-1-4-10-16-13-7-3-5-11-17-13/h12-15H,1-11H2/t12-,13?/m0/s1 |
| InChIKey | DYHYRONZPTWNOO-UEWDXFNNSA-N |
| XLogP | 1.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|