About 2-(3-methylpentoxy)oxane
2-(3-methylpentoxy)oxane (PubChem CID 14309360) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-(3-methylpentoxy)oxane.
Molecular Properties
| Compound Name | 2-(3-methylpentoxy)oxane |
| PubChem CID | 14309360 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-(3-methylpentoxy)oxane |
| SMILES | CCC(C)CCOC1CCCCO1 |
| InChI | InChI=1S/C11H22O2/c1-3-10(2)7-9-13-11-6-4-5-8-12-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | ZBZYZEDGNYZUOY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methylpentoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylpentoxy)oxane?
The IUPAC name of 2-(3-methylpentoxy)oxane (CID 14309360) is 2-(3-methylpentoxy)oxane.
What is the SMILES notation for 2-(3-methylpentoxy)oxane?
The canonical SMILES for 2-(3-methylpentoxy)oxane is CCC(C)CCOC1CCCCO1.
What is the InChIKey of 2-(3-methylpentoxy)oxane?
The InChIKey is ZBZYZEDGNYZUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-3-10(2)7-9-13-11-6-4-5-8-12-11/h10-11H,3-9H2,1-2H3.
What are the key properties of 2-(3-methylpentoxy)oxane?
2-(3-methylpentoxy)oxane has a molecular weight of 186.29 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylpentoxy)oxane is sourced from PubChem (CID 14309360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).