methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate

C15H26O4 — CID 11977271

IUPACmethyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate
SMILESCOC(=O)/C=C/CC[C@H](C)CCOC1CCCCO1
InChIInChI=1S/C15H26O4/c1-13(7-3-4-8-14(16)17-2)10-12-19-15-9-5-6-11-18-15/h4,8,13,15H,3,5-7,9-12H2,1-2H3/b8-4+/t13-,15?/m0/s1
InChIKeyMVQBDDDGXNSCLS-GMYBRRCDSA-N
MW270.37 g/mol
LogP3.07
Rot. Bonds8

About methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate

methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate (PubChem CID 11977271) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate.

Molecular Properties

Compound Namemethyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate
PubChem CID11977271
Molecular FormulaC15H26O4
Molecular Weight270.37 g/mol
Exact Mass270.18
IUPAC Namemethyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate
SMILESCOC(=O)/C=C/CC[C@H](C)CCOC1CCCCO1
InChIInChI=1S/C15H26O4/c1-13(7-3-4-8-14(16)17-2)10-12-19-15-9-5-6-11-18-15/h4,8,13,15H,3,5-7,9-12H2,1-2H3/b8-4+/t13-,15?/m0/s1
InChIKeyMVQBDDDGXNSCLS-GMYBRRCDSA-N
XLogP3.07
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.37
LogP ≤ 53.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate?
The IUPAC name of methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate (CID 11977271) is methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate.
What is the SMILES notation for methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate?
The canonical SMILES for methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate is COC(=O)/C=C/CC[C@H](C)CCOC1CCCCO1.
What is the InChIKey of methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate?
The InChIKey is MVQBDDDGXNSCLS-GMYBRRCDSA-N. The full InChI is InChI=1S/C15H26O4/c1-13(7-3-4-8-14(16)17-2)10-12-19-15-9-5-6-11-18-15/h4,8,13,15H,3,5-7,9-12H2,1-2H3/b8-4+/t13-,15?/m0/s1.
What are the key properties of methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate?
methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate has a molecular weight of 270.37 g/mol, XLogP of 3.07, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E,6S)-6-methyl-8-(oxan-2-yloxy)oct-2-enoate is sourced from PubChem (CID 11977271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).