C20H37BrO3 — CID 56619914
3-bromo-2,6,10-trimethyl-12-(oxan-2-yloxy)dodec-6-en-2-ol (PubChem CID 56619914) has the molecular formula C20H37BrO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is 3-bromo-2,6,10-trimethyl-12-(oxan-2-yloxy)dodec-6-en-2-ol.
| Compound Name | 3-bromo-2,6,10-trimethyl-12-(oxan-2-yloxy)dodec-6-en-2-ol |
|---|---|
| PubChem CID | 56619914 |
| Molecular Formula | C20H37BrO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 3-bromo-2,6,10-trimethyl-12-(oxan-2-yloxy)dodec-6-en-2-ol |
| SMILES | CC(=CCCC(C)CCOC1CCCCO1)CCC(Br)C(C)(C)O |
| InChI | InChI=1S/C20H37BrO3/c1-16(11-12-18(21)20(3,4)22)8-7-9-17(2)13-15-24-19-10-5-6-14-23-19/h8,17-19,22H,5-7,9-15H2,1-4H3 |
| InChIKey | ZMNBXQFQTRDKTJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|