C23H40O3 — CID 70162877
2,9,13-trimethyl-15-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-ol (PubChem CID 70162877) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is 2,9,13-trimethyl-15-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-ol.
| Compound Name | 2,9,13-trimethyl-15-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-ol |
|---|---|
| PubChem CID | 70162877 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | 2,9,13-trimethyl-15-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-ol |
| SMILES | CC(C)=CCCC(O)CCC(C)=CCCC(C)=CCOC1CCCCO1 |
| InChI | InChI=1S/C23H40O3/c1-19(2)9-7-12-22(24)15-14-20(3)10-8-11-21(4)16-18-26-23-13-5-6-17-25-23/h9-10,16,22-24H,5-8,11-15,17-18H2,1-4H3 |
| InChIKey | SKQRSZVGRAJMLJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|