C20H32O3 — CID 54406454
7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-1-yn-4-ol (PubChem CID 54406454) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-1-yn-4-ol.
| Compound Name | 7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-1-yn-4-ol |
|---|---|
| PubChem CID | 54406454 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-1-yn-4-ol |
| SMILES | C#CCC(O)CCC(C)=CCCC(C)=CCOC1CCCCO1 |
| InChI | InChI=1S/C20H32O3/c1-4-8-19(21)13-12-17(2)9-7-10-18(3)14-16-23-20-11-5-6-15-22-20/h1,9,14,19-21H,5-8,10-13,15-16H2,2-3H3 |
| InChIKey | VRAQCVJHTYXSHZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|