C23H38O2S2 — CID 23726956
2-[(2E,6E)-3,7-dimethyl-8-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]octa-2,6-dienoxy]oxane (PubChem CID 23726956) has the molecular formula C23H38O2S2 and a molecular weight of 410.69 g/mol. Its IUPAC name is 2-[(2E,6E)-3,7-dimethyl-8-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]octa-2,6-dienoxy]oxane.
| Compound Name | 2-[(2E,6E)-3,7-dimethyl-8-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]octa-2,6-dienoxy]oxane |
|---|---|
| PubChem CID | 23726956 |
| Molecular Formula | C23H38O2S2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[(2E,6E)-3,7-dimethyl-8-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]octa-2,6-dienoxy]oxane |
| SMILES | CC(C)=CC1(C/C(C)=C/CC/C(C)=C/COC2CCCCO2)SCCCS1 |
| InChI | InChI=1S/C23H38O2S2/c1-19(2)17-23(26-15-8-16-27-23)18-21(4)10-7-9-20(3)12-14-25-22-11-5-6-13-24-22/h10,12,17,22H,5-9,11,13-16,18H2,1-4H3/b20-12+,21-10+ |
| InChIKey | HZWMDMLFJBBVCI-VWFBFMAMSA-N |
| XLogP | 7.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|