C21H34O3 — CID 54387343
2,7,11-trimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one (PubChem CID 54387343) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 2,7,11-trimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one.
| Compound Name | 2,7,11-trimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one |
|---|---|
| PubChem CID | 54387343 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 2,7,11-trimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one |
| SMILES | CC(C)=CC(=O)CCC(C)=CCCC(C)=CCOC1CCCCO1 |
| InChI | InChI=1S/C21H34O3/c1-17(2)16-20(22)12-11-18(3)8-7-9-19(4)13-15-24-21-10-5-6-14-23-21/h8,13,16,21H,5-7,9-12,14-15H2,1-4H3 |
| InChIKey | VEDUZVCWQMPDLN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|