C16H26O4 — CID 118148188
[(2E,6E)-3,7-dimethyl-8-(oxolan-2-yloxy)octa-2,6-dienyl] acetate (PubChem CID 118148188) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is [(2E,6E)-3,7-dimethyl-8-(oxolan-2-yloxy)octa-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-3,7-dimethyl-8-(oxolan-2-yloxy)octa-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 118148188 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [(2E,6E)-3,7-dimethyl-8-(oxolan-2-yloxy)octa-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)COC1CCCO1 |
| InChI | InChI=1S/C16H26O4/c1-13(9-11-18-15(3)17)6-4-7-14(2)12-20-16-8-5-10-19-16/h7,9,16H,4-6,8,10-12H2,1-3H3/b13-9+,14-7+ |
| InChIKey | LQTPESPRZXKUIX-BTLVJFLNSA-N |
| XLogP | 3.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|