C20H36O3 — CID 67848539
3,7,11-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-ol (PubChem CID 67848539) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is 3,7,11-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-ol.
| Compound Name | 3,7,11-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-ol |
|---|---|
| PubChem CID | 67848539 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 3,7,11-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-ol |
| SMILES | CCC(C)(O)CCC=C(C)CCC=C(C)COC1CCCCO1 |
| InChI | InChI=1S/C20H36O3/c1-5-20(4,21)14-9-12-17(2)10-8-11-18(3)16-23-19-13-6-7-15-22-19/h11-12,19,21H,5-10,13-16H2,1-4H3 |
| InChIKey | HBXNUIFXQVDUFJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|