C14H24O2 — CID 10775534
2-[(2Z)-2,6-dimethylhepta-2,5-dienoxy]oxane (PubChem CID 10775534) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-[(2Z)-2,6-dimethylhepta-2,5-dienoxy]oxane.
| Compound Name | 2-[(2Z)-2,6-dimethylhepta-2,5-dienoxy]oxane |
|---|---|
| PubChem CID | 10775534 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-[(2Z)-2,6-dimethylhepta-2,5-dienoxy]oxane |
| SMILES | CC(C)=CC/C=C(/C)COC1CCCCO1 |
| InChI | InChI=1S/C14H24O2/c1-12(2)7-6-8-13(3)11-16-14-9-4-5-10-15-14/h7-8,14H,4-6,9-11H2,1-3H3/b13-8- |
| InChIKey | HMKFHLSMNRMBBJ-JYRVWZFOSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|