C17H28O4 — CID 10469860
[(2E,6Z)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] acetate (PubChem CID 10469860) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(2E,6Z)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] acetate.
| Compound Name | [(2E,6Z)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 10469860 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [(2E,6Z)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C(C)=C/CC/C(C)=C\COC1CCCCO1 |
| InChI | InChI=1S/C17H28O4/c1-14(7-6-8-15(2)13-21-16(3)18)10-12-20-17-9-4-5-11-19-17/h8,10,17H,4-7,9,11-13H2,1-3H3/b14-10-,15-8+ |
| InChIKey | IFEMUPISDZMXLR-MUBCFEGJSA-N |
| XLogP | 3.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|