C21H27BrO3 — CID 54117714
1-(4-bromophenyl)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-one (PubChem CID 54117714) has the molecular formula C21H27BrO3 and a molecular weight of 407.35 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-one.
| Compound Name | 1-(4-bromophenyl)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-one |
|---|---|
| PubChem CID | 54117714 |
| Molecular Formula | C21H27BrO3 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-(4-bromophenyl)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-one |
| SMILES | CC(=CCOC1CCCCO1)CCC=C(C)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H27BrO3/c1-16(13-15-25-20-8-3-4-14-24-20)6-5-7-17(2)21(23)18-9-11-19(22)12-10-18/h7,9-13,20H,3-6,8,14-15H2,1-2H3 |
| InChIKey | NLMYUVRNYDIRBY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|