C20H33FO2 — CID 25227676
2-[(2E,6Z)-7-(fluoromethyl)-3,11-dimethyldodeca-2,6,10-trienoxy]oxane (PubChem CID 25227676) has the molecular formula C20H33FO2 and a molecular weight of 324.48 g/mol. Its IUPAC name is 2-[(2E,6Z)-7-(fluoromethyl)-3,11-dimethyldodeca-2,6,10-trienoxy]oxane.
| Compound Name | 2-[(2E,6Z)-7-(fluoromethyl)-3,11-dimethyldodeca-2,6,10-trienoxy]oxane |
|---|---|
| PubChem CID | 25227676 |
| Molecular Formula | C20H33FO2 |
| Molecular Weight | 324.48 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 2-[(2E,6Z)-7-(fluoromethyl)-3,11-dimethyldodeca-2,6,10-trienoxy]oxane |
| SMILES | CC(C)=CCC/C(=C/CC/C(C)=C/COC1CCCCO1)CF |
| InChI | InChI=1S/C20H33FO2/c1-17(2)8-6-10-19(16-21)11-7-9-18(3)13-15-23-20-12-4-5-14-22-20/h8,11,13,20H,4-7,9-10,12,14-16H2,1-3H3/b18-13+,19-11- |
| InChIKey | HWKFOUICSZKJTD-UXXKKSSQSA-N |
| XLogP | 5.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.48 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|