C28H52O3Si — CID 10928713
tert-butyl-dimethyl-[(4E,8E,12E)-4,8,12-trimethyl-14-(oxan-2-yloxy)tetradeca-4,8,12-trienoxy]silane (PubChem CID 10928713) has the molecular formula C28H52O3Si and a molecular weight of 464.81 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4E,8E,12E)-4,8,12-trimethyl-14-(oxan-2-yloxy)tetradeca-4,8,12-trienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(4E,8E,12E)-4,8,12-trimethyl-14-(oxan-2-yloxy)tetradeca-4,8,12-trienoxy]silane |
|---|---|
| PubChem CID | 10928713 |
| Molecular Formula | C28H52O3Si |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | tert-butyl-dimethyl-[(4E,8E,12E)-4,8,12-trimethyl-14-(oxan-2-yloxy)tetradeca-4,8,12-trienoxy]silane |
| SMILES | C/C(=C\CC/C(C)=C/COC1CCCCO1)CC/C=C(\C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H52O3Si/c1-24(15-12-17-26(3)20-23-30-27-19-9-10-21-29-27)14-11-16-25(2)18-13-22-31-32(7,8)28(4,5)6/h15-16,20,27H,9-14,17-19,21-23H2,1-8H3/b24-15+,25-16+,26-20+ |
| InChIKey | LWWHSPQDLVFBRV-QKBPGNGDSA-N |
| XLogP | 8.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|