C29H53O6PSi — CID 15726389
tert-butyl-[(6E,10E)-1-diethoxyphosphoryl-6,10-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-yl]oxy-dimethylsilane (PubChem CID 15726389) has the molecular formula C29H53O6PSi and a molecular weight of 556.80 g/mol. Its IUPAC name is tert-butyl-[(6E,10E)-1-diethoxyphosphoryl-6,10-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(6E,10E)-1-diethoxyphosphoryl-6,10-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 15726389 |
| Molecular Formula | C29H53O6PSi |
| Molecular Weight | 556.80 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | tert-butyl-[(6E,10E)-1-diethoxyphosphoryl-6,10-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-yl]oxy-dimethylsilane |
| SMILES | CCOP(=O)(C#CC(CC/C(C)=C/CC/C(C)=C/COC1CCCCO1)O[Si](C)(C)C(C)(C)C)OCC |
| InChI | InChI=1S/C29H53O6PSi/c1-10-33-36(30,34-11-2)24-21-27(35-37(8,9)29(5,6)7)19-18-25(3)15-14-16-26(4)20-23-32-28-17-12-13-22-31-28/h15,20,27-28H,10-14,16-19,22-23H2,1-9H3/b25-15+,26-20+ |
| InChIKey | LXIBKZCUQWIYOJ-CZAQHAADSA-N |
| XLogP | 8.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.80 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|