C15H25N3O2 — CID 134984060
2-[(2E)-6-azido-3,7-dimethylocta-2,7-dienoxy]oxane (PubChem CID 134984060) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[(2E)-6-azido-3,7-dimethylocta-2,7-dienoxy]oxane.
| Compound Name | 2-[(2E)-6-azido-3,7-dimethylocta-2,7-dienoxy]oxane |
|---|---|
| PubChem CID | 134984060 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 2-[(2E)-6-azido-3,7-dimethylocta-2,7-dienoxy]oxane |
| SMILES | C=C(C)C(CC/C(C)=C/COC1CCCCO1)N=[N+]=[N-] |
| InChI | InChI=1S/C15H25N3O2/c1-12(2)14(17-18-16)8-7-13(3)9-11-20-15-6-4-5-10-19-15/h9,14-15H,1,4-8,10-11H2,2-3H3/b13-9+ |
| InChIKey | JFEMISNOCYWPHO-UKTHLTGXSA-N |
| XLogP | 4.51 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|