C23H40O2Si — CID 138963665
[(7E,11E)-7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-1-ynyl]-trimethylsilane (PubChem CID 138963665) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is [(7E,11E)-7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(7E,11E)-7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 138963665 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | [(7E,11E)-7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-1-ynyl]-trimethylsilane |
| SMILES | C/C(=C\COC1CCCCO1)CC/C=C(\C)CCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C23H40O2Si/c1-21(13-8-6-7-11-20-26(3,4)5)14-12-15-22(2)17-19-25-23-16-9-10-18-24-23/h14,17,23H,6-10,12-13,15-16,18-19H2,1-5H3/b21-14+,22-17+ |
| InChIKey | DCFNCSHLQNUPSP-XBVDJSGXSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|