C29H36O4 — CID 58732511
[4-[[(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienoxy]methyl]phenyl]-phenylmethanone (PubChem CID 58732511) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is [4-[[(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienoxy]methyl]phenyl]-phenylmethanone.
| Compound Name | [4-[[(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienoxy]methyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 58732511 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | [4-[[(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienoxy]methyl]phenyl]-phenylmethanone |
| SMILES | C/C(=C\COC1CCCCO1)CC/C=C(\C)COCc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H36O4/c1-23(18-20-33-28-13-6-7-19-32-28)9-8-10-24(2)21-31-22-25-14-16-27(17-15-25)29(30)26-11-4-3-5-12-26/h3-5,10-12,14-18,28H,6-9,13,19-22H2,1-2H3/b23-18+,24-10+ |
| InChIKey | GIZYQMJXOXQYTM-FZCHCXGASA-N |
| XLogP | 6.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|