C20H28O6 — CID 10992130
methyl (Z)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-(oxan-2-yloxy)but-2-enoate (PubChem CID 10992130) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is methyl (Z)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-(oxan-2-yloxy)but-2-enoate.
| Compound Name | methyl (Z)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-(oxan-2-yloxy)but-2-enoate |
|---|---|
| PubChem CID | 10992130 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | methyl (Z)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-(oxan-2-yloxy)but-2-enoate |
| SMILES | COC(=O)/C(=C\COC1CCCCO1)CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H28O6/c1-22-18-8-6-16(7-9-18)15-24-13-10-17(20(21)23-2)11-14-26-19-5-3-4-12-25-19/h6-9,11,19H,3-5,10,12-15H2,1-2H3/b17-11- |
| InChIKey | JBMHRXQDXZGCCI-BOPFTXTBSA-N |
| XLogP | 3.24 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|