C28H42O7 — CID 11123815
(2E,6S,7S,8R,9E)-6-hydroxy-8-methoxy-11-[(4-methoxyphenyl)methoxy]-3,7,9-trimethyl-1-(oxan-2-yloxy)undeca-2,9-dien-4-one (PubChem CID 11123815) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is (2E,6S,7S,8R,9E)-6-hydroxy-8-methoxy-11-[(4-methoxyphenyl)methoxy]-3,7,9-trimethyl-1-(oxan-2-yloxy)undeca-2,9-dien-4-one.
| Compound Name | (2E,6S,7S,8R,9E)-6-hydroxy-8-methoxy-11-[(4-methoxyphenyl)methoxy]-3,7,9-trimethyl-1-(oxan-2-yloxy)undeca-2,9-dien-4-one |
|---|---|
| PubChem CID | 11123815 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (2E,6S,7S,8R,9E)-6-hydroxy-8-methoxy-11-[(4-methoxyphenyl)methoxy]-3,7,9-trimethyl-1-(oxan-2-yloxy)undeca-2,9-dien-4-one |
| SMILES | COc1ccc(COC/C=C(\C)[C@H](OC)[C@@H](C)[C@@H](O)CC(=O)/C(C)=C/COC2CCCCO2)cc1 |
| InChI | InChI=1S/C28H42O7/c1-20(14-17-35-27-8-6-7-15-34-27)25(29)18-26(30)22(3)28(32-5)21(2)13-16-33-19-23-9-11-24(31-4)12-10-23/h9-14,22,26-28,30H,6-8,15-19H2,1-5H3/b20-14+,21-13+/t22-,26-,27?,28-/m0/s1 |
| InChIKey | WNKTUJCZZJSNCG-FSLJDNFDSA-N |
| XLogP | 4.62 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|