C23H38O3Si — CID 66938059
tert-butyl-[(3S,4S,5E)-7-[(4-methoxyphenyl)methoxy]-3,5-dimethylhepta-1,5-dien-4-yl]oxy-dimethylsilane (PubChem CID 66938059) has the molecular formula C23H38O3Si and a molecular weight of 390.64 g/mol. Its IUPAC name is tert-butyl-[(3S,4S,5E)-7-[(4-methoxyphenyl)methoxy]-3,5-dimethylhepta-1,5-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S,5E)-7-[(4-methoxyphenyl)methoxy]-3,5-dimethylhepta-1,5-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 66938059 |
| Molecular Formula | C23H38O3Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | tert-butyl-[(3S,4S,5E)-7-[(4-methoxyphenyl)methoxy]-3,5-dimethylhepta-1,5-dien-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H38O3Si/c1-10-18(2)22(26-27(8,9)23(4,5)6)19(3)15-16-25-17-20-11-13-21(24-7)14-12-20/h10-15,18,22H,1,16-17H2,2-9H3/b19-15+/t18-,22-/m0/s1 |
| InChIKey | GZWSDJAAHGMSHX-BMYIBGGLSA-N |
| XLogP | 6.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|