C20H34O4Si — CID 134972578
(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-4-methylpentanal (PubChem CID 134972578) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-4-methylpentanal.
| Compound Name | (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-4-methylpentanal |
|---|---|
| PubChem CID | 134972578 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-4-methylpentanal |
| SMILES | COc1ccc(COC[C@@H](C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H34O4Si/c1-16(14-23-15-17-8-10-18(22-5)11-9-17)19(12-13-21)24-25(6,7)20(2,3)4/h8-11,13,16,19H,12,14-15H2,1-7H3/t16-,19+/m1/s1 |
| InChIKey | AGXLSIFJXFPXBK-APWZRJJASA-N |
| XLogP | 4.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|