C21H37IO3Si — CID 11329357
tert-butyl-[(2R,3S,4S)-1-iodo-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentan-3-yl]oxy-dimethylsilane (PubChem CID 11329357) has the molecular formula C21H37IO3Si and a molecular weight of 492.51 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,4S)-1-iodo-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S,4S)-1-iodo-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11329357 |
| Molecular Formula | C21H37IO3Si |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | tert-butyl-[(2R,3S,4S)-1-iodo-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentan-3-yl]oxy-dimethylsilane |
| SMILES | COc1ccc(COC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CI)cc1 |
| InChI | InChI=1S/C21H37IO3Si/c1-16(13-22)20(25-26(7,8)21(3,4)5)17(2)14-24-15-18-9-11-19(23-6)12-10-18/h9-12,16-17,20H,13-15H2,1-8H3/t16-,17-,20+/m0/s1 |
| InChIKey | WGQCMFZGHLYAJN-ABSDTBQOSA-N |
| XLogP | 6.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|