C36H60O6Si — CID 10865040
(2R,3R,4R,5R,7R,8S,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-2,4,8,10-tetramethyl-1-phenylmethoxyundecane-5,7-diol (PubChem CID 10865040) has the molecular formula C36H60O6Si and a molecular weight of 616.96 g/mol. Its IUPAC name is (2R,3R,4R,5R,7R,8S,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-2,4,8,10-tetramethyl-1-phenylmethoxyundecane-5,7-diol.
| Compound Name | (2R,3R,4R,5R,7R,8S,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-2,4,8,10-tetramethyl-1-phenylmethoxyundecane-5,7-diol |
|---|---|
| PubChem CID | 10865040 |
| Molecular Formula | C36H60O6Si |
| Molecular Weight | 616.96 g/mol |
| Exact Mass | 616.42 |
| IUPAC Name | (2R,3R,4R,5R,7R,8S,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-2,4,8,10-tetramethyl-1-phenylmethoxyundecane-5,7-diol |
| SMILES | COc1ccc(CO[C@H](C(C)C)[C@@H](C)[C@H](O)C[C@@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)COCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H60O6Si/c1-25(2)34(41-24-30-17-19-31(39-9)20-18-30)27(4)32(37)21-33(38)28(5)35(42-43(10,11)36(6,7)8)26(3)22-40-23-29-15-13-12-14-16-29/h12-20,25-28,32-35,37-38H,21-24H2,1-11H3/t26-,27+,28-,32-,33-,34-,35-/m1/s1 |
| InChIKey | WNJMICJTMSGIHL-DQVOAMCBSA-N |
| XLogP | 7.86 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.96 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|