C25H44O4Si — CID 59015200
(2R,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloctanal (PubChem CID 59015200) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloctanal.
| Compound Name | (2R,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloctanal |
|---|---|
| PubChem CID | 59015200 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloctanal |
| SMILES | CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](OCc1ccc(OC)cc1)[C@@H](C)C=O |
| InChI | InChI=1S/C25H44O4Si/c1-11-18(2)24(29-30(9,10)25(5,6)7)20(4)23(19(3)16-26)28-17-21-12-14-22(27-8)15-13-21/h12-16,18-20,23-24H,11,17H2,1-10H3/t18-,19-,20+,23-,24+/m0/s1 |
| InChIKey | IUWHTZMHEFDPFW-QWYWRFGTSA-N |
| XLogP | 6.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|