C42H76O5Si2 — CID 11018005
(2S,3R,4S,5Z,8S,9R,10R,11S,12S,13Z)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol (PubChem CID 11018005) has the molecular formula C42H76O5Si2 and a molecular weight of 717.24 g/mol. Its IUPAC name is (2S,3R,4S,5Z,8S,9R,10R,11S,12S,13Z)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol.
| Compound Name | (2S,3R,4S,5Z,8S,9R,10R,11S,12S,13Z)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol |
|---|---|
| PubChem CID | 11018005 |
| Molecular Formula | C42H76O5Si2 |
| Molecular Weight | 717.24 g/mol |
| Exact Mass | 716.52 |
| IUPAC Name | (2S,3R,4S,5Z,8S,9R,10R,11S,12S,13Z)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol |
| SMILES | C=C/C=C\[C@H](C)[C@H](OCc1ccc(OC)cc1)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C42H76O5Si2/c1-19-20-21-31(3)39(45-29-36-22-24-37(44-14)25-23-36)35(7)40(47-49(17,18)42(11,12)13)33(5)27-30(2)26-32(4)38(34(6)28-43)46-48(15,16)41(8,9)10/h19-26,31-35,38-40,43H,1,27-29H2,2-18H3/b21-20-,30-26-/t31-,32-,33-,34-,35+,38+,39-,40+/m0/s1 |
| InChIKey | FMUYGCNFZHWYDB-CGMMJJGTSA-N |
| XLogP | 11.61 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.24 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|