C43H75NO5Si2 — CID 91611529
[(5S,6S,7R,8R,9S,13S,14S,15S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-18-phenoxyoctadeca-1,3,11,16-tetraen-6-yl] carbamate (PubChem CID 91611529) has the molecular formula C43H75NO5Si2 and a molecular weight of 742.25 g/mol. Its IUPAC name is [(5S,6S,7R,8R,9S,13S,14S,15S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-18-phenoxyoctadeca-1,3,11,16-tetraen-6-yl] carbamate.
| Compound Name | [(5S,6S,7R,8R,9S,13S,14S,15S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-18-phenoxyoctadeca-1,3,11,16-tetraen-6-yl] carbamate |
|---|---|
| PubChem CID | 91611529 |
| Molecular Formula | C43H75NO5Si2 |
| Molecular Weight | 742.25 g/mol |
| Exact Mass | 741.52 |
| IUPAC Name | [(5S,6S,7R,8R,9S,13S,14S,15S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-18-phenoxyoctadeca-1,3,11,16-tetraen-6-yl] carbamate |
| SMILES | C=CC=C[C@H](C)[C@H](OC(N)=O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC(C)=C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=CCOc1ccccc1 |
| InChI | InChI=1S/C43H75NO5Si2/c1-18-19-24-33(4)39(47-41(44)45)36(7)40(49-51(16,17)43(11,12)13)35(6)30-31(2)29-34(5)38(48-50(14,15)42(8,9)10)32(3)25-23-28-46-37-26-21-20-22-27-37/h18-27,29,32-36,38-40H,1,28,30H2,2-17H3,(H2,44,45)/t32-,33-,34-,35-,36+,38-,39-,40+/m0/s1 |
| InChIKey | UEQWXUDDGXFYKP-LCGUVFSPSA-N |
| XLogP | 12.13 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.25 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|