C38H71NO5Si2 — CID 11388328
[(3Z,5S,6S,7R,8R,9S,11Z,13S,14S,15S,16Z)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-18-oxononadeca-1,3,11,16-tetraen-6-yl] carbamate (PubChem CID 11388328) has the molecular formula C38H71NO5Si2 and a molecular weight of 678.16 g/mol. Its IUPAC name is [(3Z,5S,6S,7R,8R,9S,11Z,13S,14S,15S,16Z)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-18-oxononadeca-1,3,11,16-tetraen-6-yl] carbamate.
| Compound Name | [(3Z,5S,6S,7R,8R,9S,11Z,13S,14S,15S,16Z)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-18-oxononadeca-1,3,11,16-tetraen-6-yl] carbamate |
|---|---|
| PubChem CID | 11388328 |
| Molecular Formula | C38H71NO5Si2 |
| Molecular Weight | 678.16 g/mol |
| Exact Mass | 677.49 |
| IUPAC Name | [(3Z,5S,6S,7R,8R,9S,11Z,13S,14S,15S,16Z)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-18-oxononadeca-1,3,11,16-tetraen-6-yl] carbamate |
| SMILES | C=C/C=C\[C@H](C)[C@H](OC(N)=O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C\C(C)=O |
| InChI | InChI=1S/C38H71NO5Si2/c1-19-20-21-27(3)34(42-36(39)41)32(8)35(44-46(17,18)38(12,13)14)30(6)25-26(2)24-29(5)33(28(4)22-23-31(7)40)43-45(15,16)37(9,10)11/h19-24,27-30,32-35H,1,25H2,2-18H3,(H2,39,41)/b21-20-,23-22-,26-24-/t27-,28-,29-,30-,32+,33-,34-,35+/m0/s1 |
| InChIKey | HBKQKKSRPRCTAN-QTQSMGMCSA-N |
| XLogP | 10.64 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.16 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|