C38H66O6Si — CID 90829144
(2S,3R,4S,8S,9R,10R,11S,12S)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol (PubChem CID 90829144) has the molecular formula C38H66O6Si and a molecular weight of 647.03 g/mol. Its IUPAC name is (2S,3R,4S,8S,9R,10R,11S,12S)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol.
| Compound Name | (2S,3R,4S,8S,9R,10R,11S,12S)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol |
|---|---|
| PubChem CID | 90829144 |
| Molecular Formula | C38H66O6Si |
| Molecular Weight | 647.03 g/mol |
| Exact Mass | 646.46 |
| IUPAC Name | (2S,3R,4S,8S,9R,10R,11S,12S)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol |
| SMILES | C=CC=C[C@H](C)[C@H](OCc1ccc(OC)cc1)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC(C)=C[C@H](C)[C@@H](OCOC)[C@@H](C)CO |
| InChI | InChI=1S/C38H66O6Si/c1-15-16-17-28(3)36(42-25-33-18-20-34(41-12)21-19-33)32(7)37(44-45(13,14)38(8,9)10)30(5)23-27(2)22-29(4)35(31(6)24-39)43-26-40-11/h15-22,28-32,35-37,39H,1,23-26H2,2-14H3/t28-,29-,30-,31-,32+,35+,36-,37+/m0/s1 |
| InChIKey | JYQNKSFIJSKJCS-PNUPSJALSA-N |
| XLogP | 9.21 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.03 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|