C21H42O4Si — CID 11474668
(2S,3R,4S,5S,6S,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6-trimethyldeca-7,9-dien-1-ol (PubChem CID 11474668) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6-trimethyldeca-7,9-dien-1-ol.
| Compound Name | (2S,3R,4S,5S,6S,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6-trimethyldeca-7,9-dien-1-ol |
|---|---|
| PubChem CID | 11474668 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (2S,3R,4S,5S,6S,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6-trimethyldeca-7,9-dien-1-ol |
| SMILES | C=C/C=C\[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](OCOC)[C@@H](C)CO |
| InChI | InChI=1S/C21H42O4Si/c1-11-12-13-16(2)20(25-26(9,10)21(5,6)7)18(4)19(17(3)14-22)24-15-23-8/h11-13,16-20,22H,1,14-15H2,2-10H3/b13-12-/t16-,17-,18-,19+,20-/m0/s1 |
| InChIKey | RLCKMDCUZZMCBI-LBQGOHMSSA-N |
| XLogP | 5.01 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|