C25H46O4 — CID 59958302
(5Z,13Z)-3,9,11-trimethoxy-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol (PubChem CID 59958302) has the molecular formula C25H46O4 and a molecular weight of 410.64 g/mol. Its IUPAC name is (5Z,13Z)-3,9,11-trimethoxy-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol.
| Compound Name | (5Z,13Z)-3,9,11-trimethoxy-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol |
|---|---|
| PubChem CID | 59958302 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | (5Z,13Z)-3,9,11-trimethoxy-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trien-1-ol |
| SMILES | C=C/C=C\C(C)C(OC)C(C)C(OC)C(C)C/C(C)=C\C(C)C(OC)C(C)CO |
| InChI | InChI=1S/C25H46O4/c1-11-12-13-18(3)24(28-9)22(7)25(29-10)20(5)15-17(2)14-19(4)23(27-8)21(6)16-26/h11-14,18-26H,1,15-16H2,2-10H3/b13-12-,17-14- |
| InChIKey | UIJPHHNMVHGORP-WVPYDLLPSA-N |
| XLogP | 5.28 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|