C41H79IO3Si2 — CID 10996407
(3Z,5S,6S,7R,8R,9S,11Z,13S,14R,15S,16Z)-17-iodo-5,7,9,11,13,15-hexamethyl-8,14-bis[tri(propan-2-yl)silyloxy]heptadeca-1,3,11,16-tetraen-6-ol (PubChem CID 10996407) has the molecular formula C41H79IO3Si2 and a molecular weight of 803.16 g/mol. Its IUPAC name is (3Z,5S,6S,7R,8R,9S,11Z,13S,14R,15S,16Z)-17-iodo-5,7,9,11,13,15-hexamethyl-8,14-bis[tri(propan-2-yl)silyloxy]heptadeca-1,3,11,16-tetraen-6-ol.
| Compound Name | (3Z,5S,6S,7R,8R,9S,11Z,13S,14R,15S,16Z)-17-iodo-5,7,9,11,13,15-hexamethyl-8,14-bis[tri(propan-2-yl)silyloxy]heptadeca-1,3,11,16-tetraen-6-ol |
|---|---|
| PubChem CID | 10996407 |
| Molecular Formula | C41H79IO3Si2 |
| Molecular Weight | 803.16 g/mol |
| Exact Mass | 802.46 |
| IUPAC Name | (3Z,5S,6S,7R,8R,9S,11Z,13S,14R,15S,16Z)-17-iodo-5,7,9,11,13,15-hexamethyl-8,14-bis[tri(propan-2-yl)silyloxy]heptadeca-1,3,11,16-tetraen-6-ol |
| SMILES | C=C/C=C\[C@H](C)[C@H](O)[C@@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)/C=C\I |
| InChI | InChI=1S/C41H79IO3Si2/c1-20-21-22-34(15)39(43)38(19)41(45-47(30(8)9,31(10)11)32(12)13)37(18)26-33(14)25-36(17)40(35(16)23-24-42)44-46(27(2)3,28(4)5)29(6)7/h20-25,27-32,34-41,43H,1,26H2,2-19H3/b22-21-,24-23-,33-25-/t34-,35-,36-,37-,38+,39-,40-,41+/m0/s1 |
| InChIKey | FVPZSIXLPHZWAE-GMWOWLPTSA-N |
| XLogP | 13.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.16 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|