C32H49NO5 — CID 10346838
[(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z,18S)-8,14,18-trihydroxy-5,7,9,11,13,15-hexamethyl-19-phenylnonadeca-1,3,11,16-tetraen-6-yl] carbamate (PubChem CID 10346838) has the molecular formula C32H49NO5 and a molecular weight of 527.75 g/mol. Its IUPAC name is [(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z,18S)-8,14,18-trihydroxy-5,7,9,11,13,15-hexamethyl-19-phenylnonadeca-1,3,11,16-tetraen-6-yl] carbamate.
| Compound Name | [(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z,18S)-8,14,18-trihydroxy-5,7,9,11,13,15-hexamethyl-19-phenylnonadeca-1,3,11,16-tetraen-6-yl] carbamate |
|---|---|
| PubChem CID | 10346838 |
| Molecular Formula | C32H49NO5 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | [(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z,18S)-8,14,18-trihydroxy-5,7,9,11,13,15-hexamethyl-19-phenylnonadeca-1,3,11,16-tetraen-6-yl] carbamate |
| SMILES | C=C/C=C\[C@H](C)[C@H](OC(N)=O)[C@@H](C)[C@H](O)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O)[C@@H](C)/C=C\[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C32H49NO5/c1-8-9-13-23(4)31(38-32(33)37)26(7)30(36)25(6)19-21(2)18-24(5)29(35)22(3)16-17-28(34)20-27-14-11-10-12-15-27/h8-18,22-26,28-31,34-36H,1,19-20H2,2-7H3,(H2,33,37)/b13-9-,17-16-,21-18-/t22-,23-,24-,25-,26-,28+,29-,30+,31-/m0/s1 |
| InChIKey | MCHGOJWKMMAGDK-UKPGXAFHSA-N |
| XLogP | 5.59 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|