C33H45NO6 — CID 123662023
[(6S,7S,8R,9S,13S,14S)-8,14-dihydroxy-5,7,9,11,13,15-hexamethyl-17-(2-oxochromen-7-yl)heptadeca-1,3,11,16-tetraen-6-yl] carbamate (PubChem CID 123662023) has the molecular formula C33H45NO6 and a molecular weight of 551.72 g/mol. Its IUPAC name is [(6S,7S,8R,9S,13S,14S)-8,14-dihydroxy-5,7,9,11,13,15-hexamethyl-17-(2-oxochromen-7-yl)heptadeca-1,3,11,16-tetraen-6-yl] carbamate.
| Compound Name | [(6S,7S,8R,9S,13S,14S)-8,14-dihydroxy-5,7,9,11,13,15-hexamethyl-17-(2-oxochromen-7-yl)heptadeca-1,3,11,16-tetraen-6-yl] carbamate |
|---|---|
| PubChem CID | 123662023 |
| Molecular Formula | C33H45NO6 |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.32 |
| IUPAC Name | [(6S,7S,8R,9S,13S,14S)-8,14-dihydroxy-5,7,9,11,13,15-hexamethyl-17-(2-oxochromen-7-yl)heptadeca-1,3,11,16-tetraen-6-yl] carbamate |
| SMILES | C=CC=CC(C)[C@H](OC(N)=O)[C@@H](C)[C@H](O)[C@@H](C)CC(C)=C[C@H](C)[C@@H](O)C(C)C=Cc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C33H45NO6/c1-8-9-10-22(4)32(40-33(34)38)25(7)31(37)24(6)18-20(2)17-23(5)30(36)21(3)11-12-26-13-14-27-15-16-29(35)39-28(27)19-26/h8-17,19,21-25,30-32,36-37H,1,18H2,2-7H3,(H2,34,38)/t21?,22?,23-,24-,25-,30-,31+,32-/m0/s1 |
| InChIKey | IIVKILUBRJJIAE-IFOHVNFHSA-N |
| XLogP | 6.25 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|