C40H64O6Si — CID 123622041
6-[(4S,5S,9S,10R,11R,12S)-10-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-4-(methoxymethoxy)-3,5,7,9,11,13-hexamethylheptadeca-1,6,14-trienyl]chromen-2-one (PubChem CID 123622041) has the molecular formula C40H64O6Si and a molecular weight of 669.03 g/mol. Its IUPAC name is 6-[(4S,5S,9S,10R,11R,12S)-10-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-4-(methoxymethoxy)-3,5,7,9,11,13-hexamethylheptadeca-1,6,14-trienyl]chromen-2-one.
| Compound Name | 6-[(4S,5S,9S,10R,11R,12S)-10-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-4-(methoxymethoxy)-3,5,7,9,11,13-hexamethylheptadeca-1,6,14-trienyl]chromen-2-one |
|---|---|
| PubChem CID | 123622041 |
| Molecular Formula | C40H64O6Si |
| Molecular Weight | 669.03 g/mol |
| Exact Mass | 668.45 |
| IUPAC Name | 6-[(4S,5S,9S,10R,11R,12S)-10-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-4-(methoxymethoxy)-3,5,7,9,11,13-hexamethylheptadeca-1,6,14-trienyl]chromen-2-one |
| SMILES | CCC=CC(C)[C@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC(C)=C[C@H](C)[C@@H](OCOC)C(C)C=Cc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C40H64O6Si/c1-14-15-16-28(3)37(42)32(7)39(46-47(12,13)40(8,9)10)31(6)24-27(2)23-30(5)38(44-26-43-11)29(4)17-18-33-19-21-35-34(25-33)20-22-36(41)45-35/h15-23,25,28-32,37-39,42H,14,24,26H2,1-13H3/t28?,29?,30-,31-,32+,37-,38-,39+/m0/s1 |
| InChIKey | VTUGOLWFQDVDSH-WKLMFLALSA-N |
| XLogP | 10.03 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.03 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|