C20H42O3Si — CID 11728066
(E,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyldec-2-ene-1,5-diol (PubChem CID 11728066) has the molecular formula C20H42O3Si and a molecular weight of 358.64 g/mol. Its IUPAC name is (E,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyldec-2-ene-1,5-diol.
| Compound Name | (E,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyldec-2-ene-1,5-diol |
|---|---|
| PubChem CID | 11728066 |
| Molecular Formula | C20H42O3Si |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | (E,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyldec-2-ene-1,5-diol |
| SMILES | CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O)[C@H](C)/C=C(\C)CO |
| InChI | InChI=1S/C20H42O3Si/c1-11-15(3)19(23-24(9,10)20(6,7)8)17(5)18(22)16(4)12-14(2)13-21/h12,15-19,21-22H,11,13H2,1-10H3/b14-12+/t15-,16+,17+,18+,19+/m0/s1 |
| InChIKey | GYDZGWDQSFEEGM-WHGISDACSA-N |
| XLogP | 4.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|