C22H44O4Si — CID 10949401
ethyl (E,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8-tetramethyldec-2-enoate (PubChem CID 10949401) has the molecular formula C22H44O4Si and a molecular weight of 400.68 g/mol. Its IUPAC name is ethyl (E,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8-tetramethyldec-2-enoate.
| Compound Name | ethyl (E,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8-tetramethyldec-2-enoate |
|---|---|
| PubChem CID | 10949401 |
| Molecular Formula | C22H44O4Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | ethyl (E,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8-tetramethyldec-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](C)[C@@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C22H44O4Si/c1-12-15(3)20(26-27(10,11)22(7,8)9)18(6)19(23)16(4)14-17(5)21(24)25-13-2/h14-16,18-20,23H,12-13H2,1-11H3/b17-14+/t15-,16+,18+,19+,20+/m0/s1 |
| InChIKey | AIZSIEXTWCQWQD-FWKNYJKTSA-N |
| XLogP | 5.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|