C33H56O5Si — CID 101257963
ethyl (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4,6,8,10-pentamethyldodeca-2,10-dienoate (PubChem CID 101257963) has the molecular formula C33H56O5Si and a molecular weight of 560.89 g/mol. Its IUPAC name is ethyl (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4,6,8,10-pentamethyldodeca-2,10-dienoate.
| Compound Name | ethyl (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4,6,8,10-pentamethyldodeca-2,10-dienoate |
|---|---|
| PubChem CID | 101257963 |
| Molecular Formula | C33H56O5Si |
| Molecular Weight | 560.89 g/mol |
| Exact Mass | 560.39 |
| IUPAC Name | ethyl (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4,6,8,10-pentamethyldodeca-2,10-dienoate |
| SMILES | C/C=C(\C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](OCc1ccc(OC)cc1)[C@H](C)/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C33H56O5Si/c1-14-23(3)20-24(4)31(38-39(12,13)33(8,9)10)27(7)30(25(5)21-26(6)32(34)36-15-2)37-22-28-16-18-29(35-11)19-17-28/h14,16-19,21,24-25,27,30-31H,15,20,22H2,1-13H3/b23-14+,26-21+/t24-,25+,27+,30-,31+/m0/s1 |
| InChIKey | JIKPXTKELXLXIW-CYFJKLOVSA-N |
| XLogP | 8.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.89 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|