C29H46O5Si — CID 16749503
ethyl (2E,4E,6R,7R,8E)-7-[tert-butyl(dimethyl)silyl]oxy-10-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyldeca-2,4,8-trienoate (PubChem CID 16749503) has the molecular formula C29H46O5Si and a molecular weight of 502.77 g/mol. Its IUPAC name is ethyl (2E,4E,6R,7R,8E)-7-[tert-butyl(dimethyl)silyl]oxy-10-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyldeca-2,4,8-trienoate.
| Compound Name | ethyl (2E,4E,6R,7R,8E)-7-[tert-butyl(dimethyl)silyl]oxy-10-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyldeca-2,4,8-trienoate |
|---|---|
| PubChem CID | 16749503 |
| Molecular Formula | C29H46O5Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | ethyl (2E,4E,6R,7R,8E)-7-[tert-butyl(dimethyl)silyl]oxy-10-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyldeca-2,4,8-trienoate |
| SMILES | CCOC(=O)/C(C)=C/C(C)=C/[C@@H](C)[C@@H](/C=C/COCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H46O5Si/c1-11-33-28(30)24(4)20-22(2)19-23(3)27(34-35(9,10)29(5,6)7)13-12-18-32-21-25-14-16-26(31-8)17-15-25/h12-17,19-20,23,27H,11,18,21H2,1-10H3/b13-12+,22-19+,24-20+/t23-,27-/m1/s1 |
| InChIKey | LNBXBFPUCASCRM-TZYULGELSA-N |
| XLogP | 7.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|