C20H32O3Si — CID 11727786
(E,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyhex-4-enal (PubChem CID 11727786) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is (E,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyhex-4-enal.
| Compound Name | (E,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyhex-4-enal |
|---|---|
| PubChem CID | 11727786 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (E,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyhex-4-enal |
| SMILES | C[C@@H](C=O)[C@H](/C=C/COCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O3Si/c1-17(15-21)19(23-24(5,6)20(2,3)4)13-10-14-22-16-18-11-8-7-9-12-18/h7-13,15,17,19H,14,16H2,1-6H3/b13-10+/t17-,19-/m0/s1 |
| InChIKey | SIBAHBMURAZPAL-VHCSCNJLSA-N |
| XLogP | 4.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|