C20H34O3Si — CID 15000627
(2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-phenylmethoxypentanal (PubChem CID 15000627) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-phenylmethoxypentanal.
| Compound Name | (2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-phenylmethoxypentanal |
|---|---|
| PubChem CID | 15000627 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-phenylmethoxypentanal |
| SMILES | CC(C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C20H34O3Si/c1-16(13-21)19(23-24(6,7)20(3,4)5)17(2)14-22-15-18-11-9-8-10-12-18/h8-13,16-17,19H,14-15H2,1-7H3/t16?,17-,19+/m0/s1 |
| InChIKey | AEEPIQVHLBMFBQ-WFTITGEASA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|