C23H38O3Si — CID 139258405
(2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-oxo-9-phenylnonanal (PubChem CID 139258405) has the molecular formula C23H38O3Si and a molecular weight of 390.64 g/mol. Its IUPAC name is (2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-oxo-9-phenylnonanal.
| Compound Name | (2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-oxo-9-phenylnonanal |
|---|---|
| PubChem CID | 139258405 |
| Molecular Formula | C23H38O3Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-oxo-9-phenylnonanal |
| SMILES | CC(C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CCC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C23H38O3Si/c1-18(13-15-21(25)16-14-20-11-9-8-10-12-20)22(19(2)17-24)26-27(6,7)23(3,4)5/h8-12,17-19,22H,13-16H2,1-7H3/t18-,19?,22+/m1/s1 |
| InChIKey | BTINJENXWFNRDF-VWIBBUNHSA-N |
| XLogP | 5.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|