C16H26O2Si — CID 101209372
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylbutan-2-one (PubChem CID 101209372) has the molecular formula C16H26O2Si and a molecular weight of 278.47 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylbutan-2-one.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylbutan-2-one |
|---|---|
| PubChem CID | 101209372 |
| Molecular Formula | C16H26O2Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylbutan-2-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H26O2Si/c1-13(18-19(5,6)16(2,3)4)15(17)12-14-10-8-7-9-11-14/h7-11,13H,12H2,1-6H3/t13-/m0/s1 |
| InChIKey | RHSSWIQUWIIXEA-ZDUSSCGKSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|