C15H24O2SSi — CID 134886996
S-phenyl (2S)-2-[tert-butyl(dimethyl)silyl]oxypropanethioate (PubChem CID 134886996) has the molecular formula C15H24O2SSi and a molecular weight of 296.51 g/mol. Its IUPAC name is S-phenyl (2S)-2-[tert-butyl(dimethyl)silyl]oxypropanethioate.
| Compound Name | S-phenyl (2S)-2-[tert-butyl(dimethyl)silyl]oxypropanethioate |
|---|---|
| PubChem CID | 134886996 |
| Molecular Formula | C15H24O2SSi |
| Molecular Weight | 296.51 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | S-phenyl (2S)-2-[tert-butyl(dimethyl)silyl]oxypropanethioate |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C15H24O2SSi/c1-12(17-19(5,6)15(2,3)4)14(16)18-13-10-8-7-9-11-13/h7-12H,1-6H3/t12-/m0/s1 |
| InChIKey | ZVLSCJLQTBSNKI-LBPRGKRZSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|