About S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate
S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate (PubChem CID 101482188) has the molecular formula C17H36O2SSi
and a molecular weight of 332.63 g/mol. Its IUPAC name is S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate.
Molecular Properties
| Compound Name | S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate |
| PubChem CID | 101482188 |
| Molecular Formula | C17H36O2SSi |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate |
| SMILES | CCCCCCCCSC(=O)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O2SSi/c1-8-9-10-11-12-13-14-20-16(18)15(2)19-21(6,7)17(3,4)5/h15H,8-14H2,1-7H3 |
| InChIKey | CXLFXDBVTKKBNW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate?
The IUPAC name of S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate (CID 101482188) is S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate.
What is the SMILES notation for S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate?
The canonical SMILES for S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate is CCCCCCCCSC(=O)C(C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate?
The InChIKey is CXLFXDBVTKKBNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O2SSi/c1-8-9-10-11-12-13-14-20-16(18)15(2)19-21(6,7)17(3,4)5/h15H,8-14H2,1-7H3.
What are the key properties of S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate?
S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate has a molecular weight of 332.63 g/mol, XLogP of 6.02, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-octyl 2-[tert-butyl(dimethyl)silyl]oxypropanethioate is sourced from PubChem (CID 101482188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).